About 2-methylpropyl 4-[4-(2-hydroxyphenyl)-1,3-thiazol-2-yl]piperazine-1-carboxylate
2-methylpropyl 4-[4-(2-hydroxyphenyl)-1,3-thiazol-2-yl]piperazine-1-carboxylate (PubChem CID 15984510) has the molecular formula C18H23N3O3S
and a molecular weight of 361.47 g/mol. Its IUPAC name is 2-methylpropyl 4-[4-(2-hydroxyphenyl)-1,3-thiazol-2-yl]piperazine-1-carboxylate.
Molecular Properties
| Compound Name | 2-methylpropyl 4-[4-(2-hydroxyphenyl)-1,3-thiazol-2-yl]piperazine-1-carboxylate |
| PubChem CID | 15984510 |
| Molecular Formula | C18H23N3O3S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 2-methylpropyl 4-[4-(2-hydroxyphenyl)-1,3-thiazol-2-yl]piperazine-1-carboxylate |
| SMILES | CC(C)COC(=O)N1CCN(c2nc(-c3ccccc3O)cs2)CC1 |
| InChI | InChI=1S/C18H23N3O3S/c1-13(2)11-24-18(23)21-9-7-20(8-10-21)17-19-15(12-25-17)14-5-3-4-6-16(14)22/h3-6,12-13,22H,7-11H2,1-2H3 |
| InChIKey | QXUKGOFSEYCQLX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 65.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-methylpropyl 4-[4-(2-hydroxyphenyl)-1,3-thiazol-2-yl]piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl 4-[4-(2-hydroxyphenyl)-1,3-thiazol-2-yl]piperazine-1-carboxylate?
The IUPAC name of 2-methylpropyl 4-[4-(2-hydroxyphenyl)-1,3-thiazol-2-yl]piperazine-1-carboxylate (CID 15984510) is 2-methylpropyl 4-[4-(2-hydroxyphenyl)-1,3-thiazol-2-yl]piperazine-1-carboxylate.
What is the SMILES notation for 2-methylpropyl 4-[4-(2-hydroxyphenyl)-1,3-thiazol-2-yl]piperazine-1-carboxylate?
The canonical SMILES for 2-methylpropyl 4-[4-(2-hydroxyphenyl)-1,3-thiazol-2-yl]piperazine-1-carboxylate is CC(C)COC(=O)N1CCN(c2nc(-c3ccccc3O)cs2)CC1.
What is the InChIKey of 2-methylpropyl 4-[4-(2-hydroxyphenyl)-1,3-thiazol-2-yl]piperazine-1-carboxylate?
The InChIKey is QXUKGOFSEYCQLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23N3O3S/c1-13(2)11-24-18(23)21-9-7-20(8-10-21)17-19-15(12-25-17)14-5-3-4-6-16(14)22/h3-6,12-13,22H,7-11H2,1-2H3.
What are the key properties of 2-methylpropyl 4-[4-(2-hydroxyphenyl)-1,3-thiazol-2-yl]piperazine-1-carboxylate?
2-methylpropyl 4-[4-(2-hydroxyphenyl)-1,3-thiazol-2-yl]piperazine-1-carboxylate has a molecular weight of 361.47 g/mol, XLogP of 3.43, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl 4-[4-(2-hydroxyphenyl)-1,3-thiazol-2-yl]piperazine-1-carboxylate is sourced from PubChem (CID 15984510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).