About 4-[4-(2,3-dichlorophenyl)-1,3-thiazol-2-yl]piperazine-1-carboxylic acid
4-[4-(2,3-dichlorophenyl)-1,3-thiazol-2-yl]piperazine-1-carboxylic acid (PubChem CID 68780120) has the molecular formula C14H13Cl2N3O2S
and a molecular weight of 358.25 g/mol. Its IUPAC name is 4-[4-(2,3-dichlorophenyl)-1,3-thiazol-2-yl]piperazine-1-carboxylic acid.
Molecular Properties
| Compound Name | 4-[4-(2,3-dichlorophenyl)-1,3-thiazol-2-yl]piperazine-1-carboxylic acid |
| PubChem CID | 68780120 |
| Molecular Formula | C14H13Cl2N3O2S |
| Molecular Weight | 358.25 g/mol |
| Exact Mass | 357.01 |
| IUPAC Name | 4-[4-(2,3-dichlorophenyl)-1,3-thiazol-2-yl]piperazine-1-carboxylic acid |
| SMILES | O=C(O)N1CCN(c2nc(-c3cccc(Cl)c3Cl)cs2)CC1 |
| InChI | InChI=1S/C14H13Cl2N3O2S/c15-10-3-1-2-9(12(10)16)11-8-22-13(17-11)18-4-6-19(7-5-18)14(20)21/h1-3,8H,4-7H2,(H,20,21) |
| InChIKey | AGXIUASCGASVDN-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.25 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[4-(2,3-dichlorophenyl)-1,3-thiazol-2-yl]piperazine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(2,3-dichlorophenyl)-1,3-thiazol-2-yl]piperazine-1-carboxylic acid?
The IUPAC name of 4-[4-(2,3-dichlorophenyl)-1,3-thiazol-2-yl]piperazine-1-carboxylic acid (CID 68780120) is 4-[4-(2,3-dichlorophenyl)-1,3-thiazol-2-yl]piperazine-1-carboxylic acid.
What is the SMILES notation for 4-[4-(2,3-dichlorophenyl)-1,3-thiazol-2-yl]piperazine-1-carboxylic acid?
The canonical SMILES for 4-[4-(2,3-dichlorophenyl)-1,3-thiazol-2-yl]piperazine-1-carboxylic acid is O=C(O)N1CCN(c2nc(-c3cccc(Cl)c3Cl)cs2)CC1.
What is the InChIKey of 4-[4-(2,3-dichlorophenyl)-1,3-thiazol-2-yl]piperazine-1-carboxylic acid?
The InChIKey is AGXIUASCGASVDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13Cl2N3O2S/c15-10-3-1-2-9(12(10)16)11-8-22-13(17-11)18-4-6-19(7-5-18)14(20)21/h1-3,8H,4-7H2,(H,20,21).
What are the key properties of 4-[4-(2,3-dichlorophenyl)-1,3-thiazol-2-yl]piperazine-1-carboxylic acid?
4-[4-(2,3-dichlorophenyl)-1,3-thiazol-2-yl]piperazine-1-carboxylic acid has a molecular weight of 358.25 g/mol, XLogP of 3.92, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(2,3-dichlorophenyl)-1,3-thiazol-2-yl]piperazine-1-carboxylic acid is sourced from PubChem (CID 68780120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).