C14H16N2OS — CID 15984509
2-(2-piperidin-1-yl-1,3-thiazol-4-yl)phenol (PubChem CID 15984509) has the molecular formula C14H16N2OS and a molecular weight of 260.36 g/mol. Its IUPAC name is 2-(2-piperidin-1-yl-1,3-thiazol-4-yl)phenol.
| Compound Name | 2-(2-piperidin-1-yl-1,3-thiazol-4-yl)phenol |
|---|---|
| PubChem CID | 15984509 |
| Molecular Formula | C14H16N2OS |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 2-(2-piperidin-1-yl-1,3-thiazol-4-yl)phenol |
| SMILES | Oc1ccccc1-c1csc(N2CCCCC2)n1 |
| InChI | InChI=1S/C14H16N2OS/c17-13-7-3-2-6-11(13)12-10-18-14(15-12)16-8-4-1-5-9-16/h2-3,6-7,10,17H,1,4-5,8-9H2 |
| InChIKey | CIZFLLFRDXZCLM-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |