C9H8N2OS — CID 605966
2-(2-amino-1,3-thiazol-4-yl)phenol (PubChem CID 605966) has the molecular formula C9H8N2OS and a molecular weight of 192.24 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)phenol.
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)phenol |
|---|---|
| PubChem CID | 605966 |
| Molecular Formula | C9H8N2OS |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.04 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)phenol |
| SMILES | Nc1nc(-c2ccccc2O)cs1 |
| InChI | InChI=1S/C9H8N2OS/c10-9-11-7(5-13-9)6-3-1-2-4-8(6)12/h1-5,12H,(H2,10,11) |
| InChIKey | QCWXFHZAXVHMHQ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |