C15H11FN2OS — CID 972868
4-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]phenol (PubChem CID 972868) has the molecular formula C15H11FN2OS and a molecular weight of 286.33 g/mol. Its IUPAC name is 4-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]phenol.
| Compound Name | 4-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]phenol |
|---|---|
| PubChem CID | 972868 |
| Molecular Formula | C15H11FN2OS |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 4-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]phenol |
| SMILES | Oc1ccc(Nc2nc(-c3ccc(F)cc3)cs2)cc1 |
| InChI | InChI=1S/C15H11FN2OS/c16-11-3-1-10(2-4-11)14-9-20-15(18-14)17-12-5-7-13(19)8-6-12/h1-9,19H,(H,17,18) |
| InChIKey | IHEWKLRWCVXDOL-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|