C15H11N3O3S — CID 16645659
4-[[4-(4-nitrophenyl)-1,3-thiazol-2-yl]amino]phenol (PubChem CID 16645659) has the molecular formula C15H11N3O3S and a molecular weight of 313.34 g/mol. Its IUPAC name is 4-[[4-(4-nitrophenyl)-1,3-thiazol-2-yl]amino]phenol.
| Compound Name | 4-[[4-(4-nitrophenyl)-1,3-thiazol-2-yl]amino]phenol |
|---|---|
| PubChem CID | 16645659 |
| Molecular Formula | C15H11N3O3S |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 4-[[4-(4-nitrophenyl)-1,3-thiazol-2-yl]amino]phenol |
| SMILES | O=[N+]([O-])c1ccc(-c2csc(Nc3ccc(O)cc3)n2)cc1 |
| InChI | InChI=1S/C15H11N3O3S/c19-13-7-3-11(4-8-13)16-15-17-14(9-22-15)10-1-5-12(6-2-10)18(20)21/h1-9,19H,(H,16,17) |
| InChIKey | PXYPXTOUOYAWOU-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 88.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|