C17H15FN2OS — CID 25100735
4-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]-2,5-dimethylphenol (PubChem CID 25100735) has the molecular formula C17H15FN2OS and a molecular weight of 314.38 g/mol. Its IUPAC name is 4-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]-2,5-dimethylphenol.
| Compound Name | 4-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]-2,5-dimethylphenol |
|---|---|
| PubChem CID | 25100735 |
| Molecular Formula | C17H15FN2OS |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 4-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]-2,5-dimethylphenol |
| SMILES | Cc1cc(Nc2nc(-c3ccc(F)cc3)cs2)c(C)cc1O |
| InChI | InChI=1S/C17H15FN2OS/c1-10-8-16(21)11(2)7-14(10)19-17-20-15(9-22-17)12-3-5-13(18)6-4-12/h3-9,21H,1-2H3,(H,19,20) |
| InChIKey | XHCMJHJNUHSOFL-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|