C23H25N5O3S — CID 3223640
4-methoxy-N'-[2-[4-(4-phenyl-1,3-thiazol-2-yl)piperazin-1-yl]acetyl]benzohydrazide (PubChem CID 3223640) has the molecular formula C23H25N5O3S and a molecular weight of 451.55 g/mol. Its IUPAC name is 4-methoxy-N'-[2-[4-(4-phenyl-1,3-thiazol-2-yl)piperazin-1-yl]acetyl]benzohydrazide.
| Compound Name | 4-methoxy-N'-[2-[4-(4-phenyl-1,3-thiazol-2-yl)piperazin-1-yl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 3223640 |
| Molecular Formula | C23H25N5O3S |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 4-methoxy-N'-[2-[4-(4-phenyl-1,3-thiazol-2-yl)piperazin-1-yl]acetyl]benzohydrazide |
| SMILES | COc1ccc(C(=O)NNC(=O)CN2CCN(c3nc(-c4ccccc4)cs3)CC2)cc1 |
| InChI | InChI=1S/C23H25N5O3S/c1-31-19-9-7-18(8-10-19)22(30)26-25-21(29)15-27-11-13-28(14-12-27)23-24-20(16-32-23)17-5-3-2-4-6-17/h2-10,16H,11-15H2,1H3,(H,25,29)(H,26,30) |
| InChIKey | XJRBPZRIRNXNIU-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|