C21H23N4OS+ — CID 7339731
2-(4-phenylpiperazin-1-ium-1-yl)-N-(4-phenyl-1,3-thiazol-2-yl)acetamide (PubChem CID 7339731) has the molecular formula C21H23N4OS+ and a molecular weight of 379.51 g/mol. Its IUPAC name is 2-(4-phenylpiperazin-1-ium-1-yl)-N-(4-phenyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-(4-phenylpiperazin-1-ium-1-yl)-N-(4-phenyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 7339731 |
| Molecular Formula | C21H23N4OS+ |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 2-(4-phenylpiperazin-1-ium-1-yl)-N-(4-phenyl-1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(C[NH+]1CCN(c2ccccc2)CC1)Nc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C21H22N4OS/c26-20(23-21-22-19(16-27-21)17-7-3-1-4-8-17)15-24-11-13-25(14-12-24)18-9-5-2-6-10-18/h1-10,16H,11-15H2,(H,22,23,26)/p+1 |
| InChIKey | QHPQGQRBITXROR-UHFFFAOYSA-O |
| XLogP | 2.15 |
| TPSA | 49.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |