C21H24N5O2S+ — CID 7390121
2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]-N-(5-phenyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 7390121) has the molecular formula C21H24N5O2S+ and a molecular weight of 410.52 g/mol. Its IUPAC name is 2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]-N-(5-phenyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]-N-(5-phenyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 7390121 |
| Molecular Formula | C21H24N5O2S+ |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]-N-(5-phenyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | COc1ccc(N2CC[NH+](CC(=O)Nc3nnc(-c4ccccc4)s3)CC2)cc1 |
| InChI | InChI=1S/C21H23N5O2S/c1-28-18-9-7-17(8-10-18)26-13-11-25(12-14-26)15-19(27)22-21-24-23-20(29-21)16-5-3-2-4-6-16/h2-10H,11-15H2,1H3,(H,22,24,27)/p+1 |
| InChIKey | IWYDFKGZDKBGLD-UHFFFAOYSA-O |
| XLogP | 1.56 |
| TPSA | 71.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|