C23H27N5O4S — CID 3212837
N-[5-(3,4-dimethoxyphenyl)-1,3,4-thiadiazol-2-yl]-2-[4-(4-methoxyphenyl)piperazin-1-yl]acetamide (PubChem CID 3212837) has the molecular formula C23H27N5O4S and a molecular weight of 469.57 g/mol. Its IUPAC name is N-[5-(3,4-dimethoxyphenyl)-1,3,4-thiadiazol-2-yl]-2-[4-(4-methoxyphenyl)piperazin-1-yl]acetamide.
| Compound Name | N-[5-(3,4-dimethoxyphenyl)-1,3,4-thiadiazol-2-yl]-2-[4-(4-methoxyphenyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 3212837 |
| Molecular Formula | C23H27N5O4S |
| Molecular Weight | 469.57 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | N-[5-(3,4-dimethoxyphenyl)-1,3,4-thiadiazol-2-yl]-2-[4-(4-methoxyphenyl)piperazin-1-yl]acetamide |
| SMILES | COc1ccc(N2CCN(CC(=O)Nc3nnc(-c4ccc(OC)c(OC)c4)s3)CC2)cc1 |
| InChI | InChI=1S/C23H27N5O4S/c1-30-18-7-5-17(6-8-18)28-12-10-27(11-13-28)15-21(29)24-23-26-25-22(33-23)16-4-9-19(31-2)20(14-16)32-3/h4-9,14H,10-13,15H2,1-3H3,(H,24,26,29) |
| InChIKey | SCCMOIHYWHHIES-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.57 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|