C15H22ClN3S — CID 19654467
4-(4-chlorophenyl)-N-(2-methylpropyl)piperazine-1-carbothioamide (PubChem CID 19654467) has the molecular formula C15H22ClN3S and a molecular weight of 311.88 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-(2-methylpropyl)piperazine-1-carbothioamide.
| Compound Name | 4-(4-chlorophenyl)-N-(2-methylpropyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 19654467 |
| Molecular Formula | C15H22ClN3S |
| Molecular Weight | 311.88 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 4-(4-chlorophenyl)-N-(2-methylpropyl)piperazine-1-carbothioamide |
| SMILES | CC(C)CNC(=S)N1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C15H22ClN3S/c1-12(2)11-17-15(20)19-9-7-18(8-10-19)14-5-3-13(16)4-6-14/h3-6,12H,7-11H2,1-2H3,(H,17,20) |
| InChIKey | JJPOBAMMXYSRBK-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.88 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|