C18H20ClN3S — CID 19654424
4-(4-chlorophenyl)-N-(3-methylphenyl)piperazine-1-carbothioamide (PubChem CID 19654424) has the molecular formula C18H20ClN3S and a molecular weight of 345.90 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-(3-methylphenyl)piperazine-1-carbothioamide.
| Compound Name | 4-(4-chlorophenyl)-N-(3-methylphenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 19654424 |
| Molecular Formula | C18H20ClN3S |
| Molecular Weight | 345.90 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 4-(4-chlorophenyl)-N-(3-methylphenyl)piperazine-1-carbothioamide |
| SMILES | Cc1cccc(NC(=S)N2CCN(c3ccc(Cl)cc3)CC2)c1 |
| InChI | InChI=1S/C18H20ClN3S/c1-14-3-2-4-16(13-14)20-18(23)22-11-9-21(10-12-22)17-7-5-15(19)6-8-17/h2-8,13H,9-12H2,1H3,(H,20,23) |
| InChIKey | BBTDGZXFMYHRBP-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.90 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|