C17H16Cl2FN3S — CID 19654639
4-(3,4-dichlorophenyl)-N-(3-fluorophenyl)piperazine-1-carbothioamide (PubChem CID 19654639) has the molecular formula C17H16Cl2FN3S and a molecular weight of 384.31 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-N-(3-fluorophenyl)piperazine-1-carbothioamide.
| Compound Name | 4-(3,4-dichlorophenyl)-N-(3-fluorophenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 19654639 |
| Molecular Formula | C17H16Cl2FN3S |
| Molecular Weight | 384.31 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-N-(3-fluorophenyl)piperazine-1-carbothioamide |
| SMILES | Fc1cccc(NC(=S)N2CCN(c3ccc(Cl)c(Cl)c3)CC2)c1 |
| InChI | InChI=1S/C17H16Cl2FN3S/c18-15-5-4-14(11-16(15)19)22-6-8-23(9-7-22)17(24)21-13-3-1-2-12(20)10-13/h1-5,10-11H,6-9H2,(H,21,24) |
| InChIKey | NPULELRYRZMTKD-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.31 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|