C18H17ClFN3O2 — CID 44902269
2-[4-(3-chlorophenyl)piperazin-1-yl]-N-(3-fluorophenyl)-2-oxoacetamide (PubChem CID 44902269) has the molecular formula C18H17ClFN3O2 and a molecular weight of 361.80 g/mol. Its IUPAC name is 2-[4-(3-chlorophenyl)piperazin-1-yl]-N-(3-fluorophenyl)-2-oxoacetamide.
| Compound Name | 2-[4-(3-chlorophenyl)piperazin-1-yl]-N-(3-fluorophenyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 44902269 |
| Molecular Formula | C18H17ClFN3O2 |
| Molecular Weight | 361.80 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 2-[4-(3-chlorophenyl)piperazin-1-yl]-N-(3-fluorophenyl)-2-oxoacetamide |
| SMILES | O=C(Nc1cccc(F)c1)C(=O)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C18H17ClFN3O2/c19-13-3-1-6-16(11-13)22-7-9-23(10-8-22)18(25)17(24)21-15-5-2-4-14(20)12-15/h1-6,11-12H,7-10H2,(H,21,24) |
| InChIKey | IOJYLWBSGUEGIM-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.80 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|