C18H18Cl2N4O2 — CID 108516233
N-(4-amino-3-chlorophenyl)-2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoacetamide (PubChem CID 108516233) has the molecular formula C18H18Cl2N4O2 and a molecular weight of 393.27 g/mol. Its IUPAC name is N-(4-amino-3-chlorophenyl)-2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoacetamide.
| Compound Name | N-(4-amino-3-chlorophenyl)-2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 108516233 |
| Molecular Formula | C18H18Cl2N4O2 |
| Molecular Weight | 393.27 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | N-(4-amino-3-chlorophenyl)-2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoacetamide |
| SMILES | Nc1ccc(NC(=O)C(=O)N2CCN(c3cccc(Cl)c3)CC2)cc1Cl |
| InChI | InChI=1S/C18H18Cl2N4O2/c19-12-2-1-3-14(10-12)23-6-8-24(9-7-23)18(26)17(25)22-13-4-5-16(21)15(20)11-13/h1-5,10-11H,6-9,21H2,(H,22,25) |
| InChIKey | TUWSNDILIWDZTF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.27 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|