C18H19ClN4O2 — CID 44998680
2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxo-N-(pyridin-4-ylmethyl)acetamide (PubChem CID 44998680) has the molecular formula C18H19ClN4O2 and a molecular weight of 358.83 g/mol. Its IUPAC name is 2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxo-N-(pyridin-4-ylmethyl)acetamide.
| Compound Name | 2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxo-N-(pyridin-4-ylmethyl)acetamide |
|---|---|
| PubChem CID | 44998680 |
| Molecular Formula | C18H19ClN4O2 |
| Molecular Weight | 358.83 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxo-N-(pyridin-4-ylmethyl)acetamide |
| SMILES | O=C(NCc1ccncc1)C(=O)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C18H19ClN4O2/c19-15-2-1-3-16(12-15)22-8-10-23(11-9-22)18(25)17(24)21-13-14-4-6-20-7-5-14/h1-7,12H,8-11,13H2,(H,21,24) |
| InChIKey | MALXSMLDOCYNBD-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.83 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|