C20H23Cl2N3O3 — CID 60554267
N-[3-chloro-4-(2-methoxyethoxy)phenyl]-4-(3-chlorophenyl)piperazine-1-carboxamide (PubChem CID 60554267) has the molecular formula C20H23Cl2N3O3 and a molecular weight of 424.33 g/mol. Its IUPAC name is N-[3-chloro-4-(2-methoxyethoxy)phenyl]-4-(3-chlorophenyl)piperazine-1-carboxamide.
| Compound Name | N-[3-chloro-4-(2-methoxyethoxy)phenyl]-4-(3-chlorophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 60554267 |
| Molecular Formula | C20H23Cl2N3O3 |
| Molecular Weight | 424.33 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | N-[3-chloro-4-(2-methoxyethoxy)phenyl]-4-(3-chlorophenyl)piperazine-1-carboxamide |
| SMILES | COCCOc1ccc(NC(=O)N2CCN(c3cccc(Cl)c3)CC2)cc1Cl |
| InChI | InChI=1S/C20H23Cl2N3O3/c1-27-11-12-28-19-6-5-16(14-18(19)22)23-20(26)25-9-7-24(8-10-25)17-4-2-3-15(21)13-17/h2-6,13-14H,7-12H2,1H3,(H,23,26) |
| InChIKey | UZMHIIXVRWTICG-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.33 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|