C22H27ClN4O3 — CID 60586638
2-methylpropyl N-[3-[[4-(3-chlorophenyl)piperazine-1-carbonyl]amino]phenyl]carbamate (PubChem CID 60586638) has the molecular formula C22H27ClN4O3 and a molecular weight of 430.94 g/mol. Its IUPAC name is 2-methylpropyl N-[3-[[4-(3-chlorophenyl)piperazine-1-carbonyl]amino]phenyl]carbamate.
| Compound Name | 2-methylpropyl N-[3-[[4-(3-chlorophenyl)piperazine-1-carbonyl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 60586638 |
| Molecular Formula | C22H27ClN4O3 |
| Molecular Weight | 430.94 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | 2-methylpropyl N-[3-[[4-(3-chlorophenyl)piperazine-1-carbonyl]amino]phenyl]carbamate |
| SMILES | CC(C)COC(=O)Nc1cccc(NC(=O)N2CCN(c3cccc(Cl)c3)CC2)c1 |
| InChI | InChI=1S/C22H27ClN4O3/c1-16(2)15-30-22(29)25-19-7-4-6-18(14-19)24-21(28)27-11-9-26(10-12-27)20-8-3-5-17(23)13-20/h3-8,13-14,16H,9-12,15H2,1-2H3,(H,24,28)(H,25,29) |
| InChIKey | BKQXJZRVTMAMBC-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.94 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |