C17H24ClN3O3 — CID 3957217
methyl 2-[[4-(3-chlorophenyl)piperazine-1-carbonyl]amino]-3-methylbutanoate (PubChem CID 3957217) has the molecular formula C17H24ClN3O3 and a molecular weight of 353.85 g/mol. Its IUPAC name is methyl 2-[[4-(3-chlorophenyl)piperazine-1-carbonyl]amino]-3-methylbutanoate.
| Compound Name | methyl 2-[[4-(3-chlorophenyl)piperazine-1-carbonyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 3957217 |
| Molecular Formula | C17H24ClN3O3 |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | methyl 2-[[4-(3-chlorophenyl)piperazine-1-carbonyl]amino]-3-methylbutanoate |
| SMILES | COC(=O)C(NC(=O)N1CCN(c2cccc(Cl)c2)CC1)C(C)C |
| InChI | InChI=1S/C17H24ClN3O3/c1-12(2)15(16(22)24-3)19-17(23)21-9-7-20(8-10-21)14-6-4-5-13(18)11-14/h4-6,11-12,15H,7-10H2,1-3H3,(H,19,23) |
| InChIKey | QUIHFQNSIVZRBY-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |