C24H24ClN3O — CID 108867549
N-benzhydryl-4-(3-chlorophenyl)piperazine-1-carboxamide (PubChem CID 108867549) has the molecular formula C24H24ClN3O and a molecular weight of 405.93 g/mol. Its IUPAC name is N-benzhydryl-4-(3-chlorophenyl)piperazine-1-carboxamide.
| Compound Name | N-benzhydryl-4-(3-chlorophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 108867549 |
| Molecular Formula | C24H24ClN3O |
| Molecular Weight | 405.93 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | N-benzhydryl-4-(3-chlorophenyl)piperazine-1-carboxamide |
| SMILES | O=C(NC(c1ccccc1)c1ccccc1)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C24H24ClN3O/c25-21-12-7-13-22(18-21)27-14-16-28(17-15-27)24(29)26-23(19-8-3-1-4-9-19)20-10-5-2-6-11-20/h1-13,18,23H,14-17H2,(H,26,29) |
| InChIKey | UONYFLOCNXQQSZ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.93 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |