C29H30Cl2N4O2 — CID 3394778
1,3-bis[4-(3-chlorophenyl)piperazin-1-yl]-2-phenylpropane-1,3-dione (PubChem CID 3394778) has the molecular formula C29H30Cl2N4O2 and a molecular weight of 537.49 g/mol. Its IUPAC name is 1,3-bis[4-(3-chlorophenyl)piperazin-1-yl]-2-phenylpropane-1,3-dione.
| Compound Name | 1,3-bis[4-(3-chlorophenyl)piperazin-1-yl]-2-phenylpropane-1,3-dione |
|---|---|
| PubChem CID | 3394778 |
| Molecular Formula | C29H30Cl2N4O2 |
| Molecular Weight | 537.49 g/mol |
| Exact Mass | 536.17 |
| IUPAC Name | 1,3-bis[4-(3-chlorophenyl)piperazin-1-yl]-2-phenylpropane-1,3-dione |
| SMILES | O=C(C(C(=O)N1CCN(c2cccc(Cl)c2)CC1)c1ccccc1)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C29H30Cl2N4O2/c30-23-8-4-10-25(20-23)32-12-16-34(17-13-32)28(36)27(22-6-2-1-3-7-22)29(37)35-18-14-33(15-19-35)26-11-5-9-24(31)21-26/h1-11,20-21,27H,12-19H2 |
| InChIKey | AKOJSMOSNJHZIQ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.49 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|