C18H21ClN4O — CID 33433718
4-(3-chlorophenyl)-N-[(1S)-1-pyridin-4-ylethyl]piperazine-1-carboxamide (PubChem CID 33433718) has the molecular formula C18H21ClN4O and a molecular weight of 344.85 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-N-[(1S)-1-pyridin-4-ylethyl]piperazine-1-carboxamide.
| Compound Name | 4-(3-chlorophenyl)-N-[(1S)-1-pyridin-4-ylethyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 33433718 |
| Molecular Formula | C18H21ClN4O |
| Molecular Weight | 344.85 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 4-(3-chlorophenyl)-N-[(1S)-1-pyridin-4-ylethyl]piperazine-1-carboxamide |
| SMILES | C[C@H](NC(=O)N1CCN(c2cccc(Cl)c2)CC1)c1ccncc1 |
| InChI | InChI=1S/C18H21ClN4O/c1-14(15-5-7-20-8-6-15)21-18(24)23-11-9-22(10-12-23)17-4-2-3-16(19)13-17/h2-8,13-14H,9-12H2,1H3,(H,21,24)/t14-/m0/s1 |
| InChIKey | PIUOPAAPHDZRHU-AWEZNQCLSA-N |
| XLogP | 3.33 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.85 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |