C18H25ClN4O2S — CID 53368553
4-(3-chlorophenyl)-N-(1-oxo-1-thiomorpholin-4-ylpropan-2-yl)piperazine-1-carboxamide (PubChem CID 53368553) has the molecular formula C18H25ClN4O2S and a molecular weight of 396.94 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-N-(1-oxo-1-thiomorpholin-4-ylpropan-2-yl)piperazine-1-carboxamide.
| Compound Name | 4-(3-chlorophenyl)-N-(1-oxo-1-thiomorpholin-4-ylpropan-2-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 53368553 |
| Molecular Formula | C18H25ClN4O2S |
| Molecular Weight | 396.94 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 4-(3-chlorophenyl)-N-(1-oxo-1-thiomorpholin-4-ylpropan-2-yl)piperazine-1-carboxamide |
| SMILES | CC(NC(=O)N1CCN(c2cccc(Cl)c2)CC1)C(=O)N1CCSCC1 |
| InChI | InChI=1S/C18H25ClN4O2S/c1-14(17(24)22-9-11-26-12-10-22)20-18(25)23-7-5-21(6-8-23)16-4-2-3-15(19)13-16/h2-4,13-14H,5-12H2,1H3,(H,20,25) |
| InChIKey | HPGLLKGIOXUEGM-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.94 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |