C17H24IN3O3 — CID 58412987
methyl (2S)-2-[[4-(4-iodophenyl)piperazine-1-carbonyl]amino]-3-methylbutanoate (PubChem CID 58412987) has the molecular formula C17H24IN3O3 and a molecular weight of 445.30 g/mol. Its IUPAC name is methyl (2S)-2-[[4-(4-iodophenyl)piperazine-1-carbonyl]amino]-3-methylbutanoate.
| Compound Name | methyl (2S)-2-[[4-(4-iodophenyl)piperazine-1-carbonyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 58412987 |
| Molecular Formula | C17H24IN3O3 |
| Molecular Weight | 445.30 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | methyl (2S)-2-[[4-(4-iodophenyl)piperazine-1-carbonyl]amino]-3-methylbutanoate |
| SMILES | COC(=O)[C@@H](NC(=O)N1CCN(c2ccc(I)cc2)CC1)C(C)C |
| InChI | InChI=1S/C17H24IN3O3/c1-12(2)15(16(22)24-3)19-17(23)21-10-8-20(9-11-21)14-6-4-13(18)5-7-14/h4-7,12,15H,8-11H2,1-3H3,(H,19,23)/t15-/m0/s1 |
| InChIKey | HOIZXCFRWWSLGU-HNNXBMFYSA-N |
| XLogP | 2.32 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.30 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|