C17H24FN3O5S — CID 74661727
methyl 2-[[4-(4-fluorophenyl)sulfonylpiperazine-1-carbonyl]amino]-3-methylbutanoate (PubChem CID 74661727) has the molecular formula C17H24FN3O5S and a molecular weight of 401.46 g/mol. Its IUPAC name is methyl 2-[[4-(4-fluorophenyl)sulfonylpiperazine-1-carbonyl]amino]-3-methylbutanoate.
| Compound Name | methyl 2-[[4-(4-fluorophenyl)sulfonylpiperazine-1-carbonyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 74661727 |
| Molecular Formula | C17H24FN3O5S |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | methyl 2-[[4-(4-fluorophenyl)sulfonylpiperazine-1-carbonyl]amino]-3-methylbutanoate |
| SMILES | COC(=O)C(NC(=O)N1CCN(S(=O)(=O)c2ccc(F)cc2)CC1)C(C)C |
| InChI | InChI=1S/C17H24FN3O5S/c1-12(2)15(16(22)26-3)19-17(23)20-8-10-21(11-9-20)27(24,25)14-6-4-13(18)5-7-14/h4-7,12,15H,8-11H2,1-3H3,(H,19,23) |
| InChIKey | WFZUIKHOKYGLSP-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |