C18H27N3O6S — CID 39333172
methyl (2S)-2-[[4-(4-methoxyphenyl)sulfonylpiperazine-1-carbonyl]amino]-3-methylbutanoate (PubChem CID 39333172) has the molecular formula C18H27N3O6S and a molecular weight of 413.50 g/mol. Its IUPAC name is methyl (2S)-2-[[4-(4-methoxyphenyl)sulfonylpiperazine-1-carbonyl]amino]-3-methylbutanoate.
| Compound Name | methyl (2S)-2-[[4-(4-methoxyphenyl)sulfonylpiperazine-1-carbonyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 39333172 |
| Molecular Formula | C18H27N3O6S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | methyl (2S)-2-[[4-(4-methoxyphenyl)sulfonylpiperazine-1-carbonyl]amino]-3-methylbutanoate |
| SMILES | COC(=O)[C@@H](NC(=O)N1CCN(S(=O)(=O)c2ccc(OC)cc2)CC1)C(C)C |
| InChI | InChI=1S/C18H27N3O6S/c1-13(2)16(17(22)27-4)19-18(23)20-9-11-21(12-10-20)28(24,25)15-7-5-14(26-3)6-8-15/h5-8,13,16H,9-12H2,1-4H3,(H,19,23)/t16-/m0/s1 |
| InChIKey | NMEPZPUENCHQFW-INIZCTEOSA-N |
| XLogP | 0.91 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |