C19H24N4O4S — CID 33433764
4-(4-methoxyphenyl)sulfonyl-N-[(1R)-1-pyridin-4-ylethyl]piperazine-1-carboxamide (PubChem CID 33433764) has the molecular formula C19H24N4O4S and a molecular weight of 404.49 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)sulfonyl-N-[(1R)-1-pyridin-4-ylethyl]piperazine-1-carboxamide.
| Compound Name | 4-(4-methoxyphenyl)sulfonyl-N-[(1R)-1-pyridin-4-ylethyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 33433764 |
| Molecular Formula | C19H24N4O4S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 4-(4-methoxyphenyl)sulfonyl-N-[(1R)-1-pyridin-4-ylethyl]piperazine-1-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(C(=O)N[C@H](C)c3ccncc3)CC2)cc1 |
| InChI | InChI=1S/C19H24N4O4S/c1-15(16-7-9-20-10-8-16)21-19(24)22-11-13-23(14-12-22)28(25,26)18-5-3-17(27-2)4-6-18/h3-10,15H,11-14H2,1-2H3,(H,21,24)/t15-/m1/s1 |
| InChIKey | SCJBAOWSCRKOIR-OAHLLOKOSA-N |
| XLogP | 1.87 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |