C22H25N5O4 — CID 58412980
methyl (2S,3R)-3-hydroxy-2-[[4-[4-(2-pyrazin-2-ylethynyl)phenyl]piperazine-1-carbonyl]amino]butanoate (PubChem CID 58412980) has the molecular formula C22H25N5O4 and a molecular weight of 423.47 g/mol. Its IUPAC name is methyl (2S,3R)-3-hydroxy-2-[[4-[4-(2-pyrazin-2-ylethynyl)phenyl]piperazine-1-carbonyl]amino]butanoate.
| Compound Name | methyl (2S,3R)-3-hydroxy-2-[[4-[4-(2-pyrazin-2-ylethynyl)phenyl]piperazine-1-carbonyl]amino]butanoate |
|---|---|
| PubChem CID | 58412980 |
| Molecular Formula | C22H25N5O4 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | methyl (2S,3R)-3-hydroxy-2-[[4-[4-(2-pyrazin-2-ylethynyl)phenyl]piperazine-1-carbonyl]amino]butanoate |
| SMILES | COC(=O)[C@@H](NC(=O)N1CCN(c2ccc(C#Cc3cnccn3)cc2)CC1)[C@@H](C)O |
| InChI | InChI=1S/C22H25N5O4/c1-16(28)20(21(29)31-2)25-22(30)27-13-11-26(12-14-27)19-7-4-17(5-8-19)3-6-18-15-23-9-10-24-18/h4-5,7-10,15-16,20,28H,11-14H2,1-2H3,(H,25,30)/t16-,20+/m1/s1 |
| InChIKey | YJPUVOFGGWIXKK-UZLBHIALSA-N |
| XLogP | 0.63 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|