C19H24N6O4 — CID 88903695
N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-(4-pyrazin-2-ylphenyl)piperazine-1-carboxamide (PubChem CID 88903695) has the molecular formula C19H24N6O4 and a molecular weight of 400.44 g/mol. Its IUPAC name is N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-(4-pyrazin-2-ylphenyl)piperazine-1-carboxamide.
| Compound Name | N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-(4-pyrazin-2-ylphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 88903695 |
| Molecular Formula | C19H24N6O4 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-(4-pyrazin-2-ylphenyl)piperazine-1-carboxamide |
| SMILES | C[C@@H](O)[C@H](NC(=O)N1CCN(c2ccc(-c3cnccn3)cc2)CC1)C(=O)NO |
| InChI | InChI=1S/C19H24N6O4/c1-13(26)17(18(27)23-29)22-19(28)25-10-8-24(9-11-25)15-4-2-14(3-5-15)16-12-20-6-7-21-16/h2-7,12-13,17,26,29H,8-11H2,1H3,(H,22,28)(H,23,27)/t13-,17+/m1/s1 |
| InChIKey | MKGFLXAGCJWYIL-DYVFJYSZSA-N |
| XLogP | 0.23 |
| TPSA | 130.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|