C20H24FN5O4 — CID 88903709
4-[4-(3-fluoro-4-pyridinyl)phenyl]-N-[(2R,3S)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]piperazine-1-carboxamide (PubChem CID 88903709) has the molecular formula C20H24FN5O4 and a molecular weight of 417.44 g/mol. Its IUPAC name is 4-[4-(3-fluoro-4-pyridinyl)phenyl]-N-[(2R,3S)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]piperazine-1-carboxamide.
| Compound Name | 4-[4-(3-fluoro-4-pyridinyl)phenyl]-N-[(2R,3S)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 88903709 |
| Molecular Formula | C20H24FN5O4 |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 4-[4-(3-fluoro-4-pyridinyl)phenyl]-N-[(2R,3S)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]piperazine-1-carboxamide |
| SMILES | C[C@H](O)[C@@H](NC(=O)N1CCN(c2ccc(-c3ccncc3F)cc2)CC1)C(=O)NO |
| InChI | InChI=1S/C20H24FN5O4/c1-13(27)18(19(28)24-30)23-20(29)26-10-8-25(9-11-26)15-4-2-14(3-5-15)16-6-7-22-12-17(16)21/h2-7,12-13,18,27,30H,8-11H2,1H3,(H,23,29)(H,24,28)/t13-,18+/m0/s1 |
| InChIKey | WFJLHMOCFIRLHB-SCLBCKFNSA-N |
| XLogP | 0.97 |
| TPSA | 118.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|