C25H34N6O4 — CID 88903970
N-[(2R,3S)-3-amino-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[4-(4-morpholin-4-ylphenyl)phenyl]piperazine-1-carboxamide (PubChem CID 88903970) has the molecular formula C25H34N6O4 and a molecular weight of 482.59 g/mol. Its IUPAC name is N-[(2R,3S)-3-amino-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[4-(4-morpholin-4-ylphenyl)phenyl]piperazine-1-carboxamide.
| Compound Name | N-[(2R,3S)-3-amino-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[4-(4-morpholin-4-ylphenyl)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 88903970 |
| Molecular Formula | C25H34N6O4 |
| Molecular Weight | 482.59 g/mol |
| Exact Mass | 482.26 |
| IUPAC Name | N-[(2R,3S)-3-amino-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[4-(4-morpholin-4-ylphenyl)phenyl]piperazine-1-carboxamide |
| SMILES | C[C@H](N)[C@@H](NC(=O)N1CCN(c2ccc(-c3ccc(N4CCOCC4)cc3)cc2)CC1)C(=O)NO |
| InChI | InChI=1S/C25H34N6O4/c1-18(26)23(24(32)28-34)27-25(33)31-12-10-29(11-13-31)21-6-2-19(3-7-21)20-4-8-22(9-5-20)30-14-16-35-17-15-30/h2-9,18,23,34H,10-17,26H2,1H3,(H,27,33)(H,28,32)/t18-,23+/m0/s1 |
| InChIKey | MZLBXPCYXOGUEG-FDDCHVKYSA-N |
| XLogP | 1.24 |
| TPSA | 123.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.59 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|