C23H30N4O4 — CID 89047977
N-[(2S,3R)-3-amino-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[4-(1,4-oxazepan-4-ylmethyl)phenyl]benzamide (PubChem CID 89047977) has the molecular formula C23H30N4O4 and a molecular weight of 426.52 g/mol. Its IUPAC name is N-[(2S,3R)-3-amino-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[4-(1,4-oxazepan-4-ylmethyl)phenyl]benzamide.
| Compound Name | N-[(2S,3R)-3-amino-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[4-(1,4-oxazepan-4-ylmethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 89047977 |
| Molecular Formula | C23H30N4O4 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | N-[(2S,3R)-3-amino-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[4-(1,4-oxazepan-4-ylmethyl)phenyl]benzamide |
| SMILES | C[C@@H](N)[C@H](NC(=O)c1ccc(-c2ccc(CN3CCCOCC3)cc2)cc1)C(=O)NO |
| InChI | InChI=1S/C23H30N4O4/c1-16(24)21(23(29)26-30)25-22(28)20-9-7-19(8-10-20)18-5-3-17(4-6-18)15-27-11-2-13-31-14-12-27/h3-10,16,21,30H,2,11-15,24H2,1H3,(H,25,28)(H,26,29)/t16-,21+/m1/s1 |
| InChIKey | MARMJHRCFUHLAK-IERDGZPVSA-N |
| XLogP | 1.53 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|