C24H30N4O4 — CID 89048229
N-[(2S,3R)-3-amino-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[(E)-2-[4-(morpholin-4-ylmethyl)phenyl]ethenyl]benzamide (PubChem CID 89048229) has the molecular formula C24H30N4O4 and a molecular weight of 438.53 g/mol. Its IUPAC name is N-[(2S,3R)-3-amino-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[(E)-2-[4-(morpholin-4-ylmethyl)phenyl]ethenyl]benzamide.
| Compound Name | N-[(2S,3R)-3-amino-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[(E)-2-[4-(morpholin-4-ylmethyl)phenyl]ethenyl]benzamide |
|---|---|
| PubChem CID | 89048229 |
| Molecular Formula | C24H30N4O4 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | N-[(2S,3R)-3-amino-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[(E)-2-[4-(morpholin-4-ylmethyl)phenyl]ethenyl]benzamide |
| SMILES | C[C@@H](N)[C@H](NC(=O)c1ccc(/C=C/c2ccc(CN3CCOCC3)cc2)cc1)C(=O)NO |
| InChI | InChI=1S/C24H30N4O4/c1-17(25)22(24(30)27-31)26-23(29)21-10-8-19(9-11-21)3-2-18-4-6-20(7-5-18)16-28-12-14-32-15-13-28/h2-11,17,22,31H,12-16,25H2,1H3,(H,26,29)(H,27,30)/b3-2+/t17-,22+/m1/s1 |
| InChIKey | ATKGHFNEQFGLJR-MFRBVNFKSA-N |
| XLogP | 1.64 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|