C26H35N5O5 — CID 91504815
N-[3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[4-[4-(morpholin-4-ylmethyl)phenyl]piperazin-1-yl]benzamide (PubChem CID 91504815) has the molecular formula C26H35N5O5 and a molecular weight of 497.60 g/mol. Its IUPAC name is N-[3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[4-[4-(morpholin-4-ylmethyl)phenyl]piperazin-1-yl]benzamide.
| Compound Name | N-[3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[4-[4-(morpholin-4-ylmethyl)phenyl]piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 91504815 |
| Molecular Formula | C26H35N5O5 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.26 |
| IUPAC Name | N-[3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[4-[4-(morpholin-4-ylmethyl)phenyl]piperazin-1-yl]benzamide |
| SMILES | CC(O)C(NC(=O)c1ccc(N2CCN(c3ccc(CN4CCOCC4)cc3)CC2)cc1)C(=O)NO |
| InChI | InChI=1S/C26H35N5O5/c1-19(32)24(26(34)28-35)27-25(33)21-4-8-23(9-5-21)31-12-10-30(11-13-31)22-6-2-20(3-7-22)18-29-14-16-36-17-15-29/h2-9,19,24,32,35H,10-18H2,1H3,(H,27,33)(H,28,34) |
| InChIKey | RGBUXUYMDKDTPN-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|