C22H28N4O4 — CID 53318298
N-[(2R)-3-hydroxy-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-(4-phenylphenyl)piperazine-1-carboxamide (PubChem CID 53318298) has the molecular formula C22H28N4O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is N-[(2R)-3-hydroxy-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-(4-phenylphenyl)piperazine-1-carboxamide.
| Compound Name | N-[(2R)-3-hydroxy-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-(4-phenylphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 53318298 |
| Molecular Formula | C22H28N4O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | N-[(2R)-3-hydroxy-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-(4-phenylphenyl)piperazine-1-carboxamide |
| SMILES | CC(C)(O)[C@@H](NC(=O)N1CCN(c2ccc(-c3ccccc3)cc2)CC1)C(=O)NO |
| InChI | InChI=1S/C22H28N4O4/c1-22(2,29)19(20(27)24-30)23-21(28)26-14-12-25(13-15-26)18-10-8-17(9-11-18)16-6-4-3-5-7-16/h3-11,19,29-30H,12-15H2,1-2H3,(H,23,28)(H,24,27)/t19-/m0/s1 |
| InChIKey | SIVILNBKTVDFQQ-IBGZPJMESA-N |
| XLogP | 1.83 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|