C22H27N3O4 — CID 44633511
N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-(4-phenylphenyl)piperidine-1-carboxamide (PubChem CID 44633511) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-(4-phenylphenyl)piperidine-1-carboxamide.
| Compound Name | N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-(4-phenylphenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 44633511 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-(4-phenylphenyl)piperidine-1-carboxamide |
| SMILES | C[C@@H](O)[C@H](NC(=O)N1CCC(c2ccc(-c3ccccc3)cc2)CC1)C(=O)NO |
| InChI | InChI=1S/C22H27N3O4/c1-15(26)20(21(27)24-29)23-22(28)25-13-11-19(12-14-25)18-9-7-17(8-10-18)16-5-3-2-4-6-16/h2-10,15,19-20,26,29H,11-14H2,1H3,(H,23,28)(H,24,27)/t15-,20+/m1/s1 |
| InChIKey | CLSVZDVMSBFQPQ-QRWLVFNGSA-N |
| XLogP | 2.50 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|