C32H34N4O5 — CID 59697008
N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[2-[4-[[2-(4-phenylpiperidin-1-yl)acetyl]amino]phenyl]ethynyl]benzamide (PubChem CID 59697008) has the molecular formula C32H34N4O5 and a molecular weight of 554.65 g/mol. Its IUPAC name is N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[2-[4-[[2-(4-phenylpiperidin-1-yl)acetyl]amino]phenyl]ethynyl]benzamide.
| Compound Name | N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[2-[4-[[2-(4-phenylpiperidin-1-yl)acetyl]amino]phenyl]ethynyl]benzamide |
|---|---|
| PubChem CID | 59697008 |
| Molecular Formula | C32H34N4O5 |
| Molecular Weight | 554.65 g/mol |
| Exact Mass | 554.25 |
| IUPAC Name | N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[2-[4-[[2-(4-phenylpiperidin-1-yl)acetyl]amino]phenyl]ethynyl]benzamide |
| SMILES | C[C@@H](O)[C@H](NC(=O)c1ccc(C#Cc2ccc(NC(=O)CN3CCC(c4ccccc4)CC3)cc2)cc1)C(=O)NO |
| InChI | InChI=1S/C32H34N4O5/c1-22(37)30(32(40)35-41)34-31(39)27-13-9-23(10-14-27)7-8-24-11-15-28(16-12-24)33-29(38)21-36-19-17-26(18-20-36)25-5-3-2-4-6-25/h2-6,9-16,22,26,30,37,41H,17-21H2,1H3,(H,33,38)(H,34,39)(H,35,40)/t22-,30+/m1/s1 |
| InChIKey | XFGRSUBAWCVQOO-RCRUUEGKSA-N |
| XLogP | 2.89 |
| TPSA | 131.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.65 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|