C30H34N4O5 — CID 88873816
N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[4-[[2-(4-phenylpiperidin-1-yl)acetyl]amino]phenyl]benzamide (PubChem CID 88873816) has the molecular formula C30H34N4O5 and a molecular weight of 530.63 g/mol. Its IUPAC name is N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[4-[[2-(4-phenylpiperidin-1-yl)acetyl]amino]phenyl]benzamide.
| Compound Name | N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[4-[[2-(4-phenylpiperidin-1-yl)acetyl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 88873816 |
| Molecular Formula | C30H34N4O5 |
| Molecular Weight | 530.63 g/mol |
| Exact Mass | 530.25 |
| IUPAC Name | N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[4-[[2-(4-phenylpiperidin-1-yl)acetyl]amino]phenyl]benzamide |
| SMILES | C[C@@H](O)[C@H](NC(=O)c1ccc(-c2ccc(NC(=O)CN3CCC(c4ccccc4)CC3)cc2)cc1)C(=O)NO |
| InChI | InChI=1S/C30H34N4O5/c1-20(35)28(30(38)33-39)32-29(37)25-9-7-22(8-10-25)23-11-13-26(14-12-23)31-27(36)19-34-17-15-24(16-18-34)21-5-3-2-4-6-21/h2-14,20,24,28,35,39H,15-19H2,1H3,(H,31,36)(H,32,37)(H,33,38)/t20-,28+/m1/s1 |
| InChIKey | HWCKDDSGTSBITO-NGOKVRLYSA-N |
| XLogP | 3.16 |
| TPSA | 131.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.63 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|