C28H30N4O5 — CID 89327611
N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[4-[[2-[[(1R,2R)-2-phenylcyclopropyl]amino]acetyl]amino]phenyl]benzamide (PubChem CID 89327611) has the molecular formula C28H30N4O5 and a molecular weight of 502.57 g/mol. Its IUPAC name is N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[4-[[2-[[(1R,2R)-2-phenylcyclopropyl]amino]acetyl]amino]phenyl]benzamide.
| Compound Name | N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[4-[[2-[[(1R,2R)-2-phenylcyclopropyl]amino]acetyl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 89327611 |
| Molecular Formula | C28H30N4O5 |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[4-[[2-[[(1R,2R)-2-phenylcyclopropyl]amino]acetyl]amino]phenyl]benzamide |
| SMILES | C[C@@H](O)[C@H](NC(=O)c1ccc(-c2ccc(NC(=O)CN[C@@H]3C[C@@H]3c3ccccc3)cc2)cc1)C(=O)NO |
| InChI | InChI=1S/C28H30N4O5/c1-17(33)26(28(36)32-37)31-27(35)21-9-7-18(8-10-21)19-11-13-22(14-12-19)30-25(34)16-29-24-15-23(24)20-5-3-2-4-6-20/h2-14,17,23-24,26,29,33,37H,15-16H2,1H3,(H,30,34)(H,31,35)(H,32,36)/t17-,23-,24-,26+/m1/s1 |
| InChIKey | LSVHNBWQGQFIFZ-KPPCOUORSA-N |
| XLogP | 2.42 |
| TPSA | 139.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|