C26H32N4O5 — CID 87199740
4-[4-[[2-[[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]amino]acetyl]amino]phenyl]-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide (PubChem CID 87199740) has the molecular formula C26H32N4O5 and a molecular weight of 480.57 g/mol. Its IUPAC name is 4-[4-[[2-[[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]amino]acetyl]amino]phenyl]-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-[4-[[2-[[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]amino]acetyl]amino]phenyl]-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 87199740 |
| Molecular Formula | C26H32N4O5 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | 4-[4-[[2-[[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]amino]acetyl]amino]phenyl]-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide |
| SMILES | C[C@@H](O)[C@H](NC(=O)c1ccc(-c2ccc(NC(=O)CN[C@@H]3C[C@H]4CC[C@@H]3C4)cc2)cc1)C(=O)NO |
| InChI | InChI=1S/C26H32N4O5/c1-15(31)24(26(34)30-35)29-25(33)19-6-4-17(5-7-19)18-8-10-21(11-9-18)28-23(32)14-27-22-13-16-2-3-20(22)12-16/h4-11,15-16,20,22,24,27,31,35H,2-3,12-14H2,1H3,(H,28,32)(H,29,33)(H,30,34)/t15-,16+,20-,22-,24+/m1/s1 |
| InChIKey | XFQYWFTWXLLNPJ-IHNZGGLHSA-N |
| XLogP | 2.05 |
| TPSA | 139.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|