C27H34N4O5 — CID 157387809
4-[2-[4-[[2-(cyclopentylamino)acetyl]amino]phenyl]ethynyl]-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide;methane (PubChem CID 157387809) has the molecular formula C27H34N4O5 and a molecular weight of 494.59 g/mol. Its IUPAC name is 4-[2-[4-[[2-(cyclopentylamino)acetyl]amino]phenyl]ethynyl]-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide;methane.
| Compound Name | 4-[2-[4-[[2-(cyclopentylamino)acetyl]amino]phenyl]ethynyl]-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide;methane |
|---|---|
| PubChem CID | 157387809 |
| Molecular Formula | C27H34N4O5 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | 4-[2-[4-[[2-(cyclopentylamino)acetyl]amino]phenyl]ethynyl]-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide;methane |
| SMILES | C.C[C@@H](O)[C@H](NC(=O)c1ccc(C#Cc2ccc(NC(=O)CNC3CCCC3)cc2)cc1)C(=O)NO |
| InChI | InChI=1S/C26H30N4O5.CH4/c1-17(31)24(26(34)30-35)29-25(33)20-12-8-18(9-13-20)6-7-19-10-14-22(15-11-19)28-23(32)16-27-21-4-2-3-5-21;/h8-15,17,21,24,27,31,35H,2-5,16H2,1H3,(H,28,32)(H,29,33)(H,30,34);1H4/t17-,24+;/m1./s1 |
| InChIKey | BLQFFLDGEMWCAL-NDZTXGRGSA-N |
| XLogP | 2.18 |
| TPSA | 139.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|