C29H35N5O4 — CID 59697431
4-[2-[4-[[2-(cyclobutylamino)acetyl]amino]phenyl]ethynyl]-N-[3-(cyclobutylamino)-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide (PubChem CID 59697431) has the molecular formula C29H35N5O4 and a molecular weight of 517.63 g/mol. Its IUPAC name is 4-[2-[4-[[2-(cyclobutylamino)acetyl]amino]phenyl]ethynyl]-N-[3-(cyclobutylamino)-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-[2-[4-[[2-(cyclobutylamino)acetyl]amino]phenyl]ethynyl]-N-[3-(cyclobutylamino)-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 59697431 |
| Molecular Formula | C29H35N5O4 |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.27 |
| IUPAC Name | 4-[2-[4-[[2-(cyclobutylamino)acetyl]amino]phenyl]ethynyl]-N-[3-(cyclobutylamino)-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide |
| SMILES | CC(NC1CCC1)C(NC(=O)c1ccc(C#Cc2ccc(NC(=O)CNC3CCC3)cc2)cc1)C(=O)NO |
| InChI | InChI=1S/C29H35N5O4/c1-19(31-24-6-3-7-24)27(29(37)34-38)33-28(36)22-14-10-20(11-15-22)8-9-21-12-16-25(17-13-21)32-26(35)18-30-23-4-2-5-23/h10-17,19,23-24,27,30-31,38H,2-7,18H2,1H3,(H,32,35)(H,33,36)(H,34,37) |
| InChIKey | RQMTZWWYMKRRRJ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 131.59 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|