C18H23N3O4 — CID 59324043
4-but-2-ynoxy-N-[(2S,3R)-3-(cyclopropylamino)-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide (PubChem CID 59324043) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is 4-but-2-ynoxy-N-[(2S,3R)-3-(cyclopropylamino)-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-but-2-ynoxy-N-[(2S,3R)-3-(cyclopropylamino)-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 59324043 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 4-but-2-ynoxy-N-[(2S,3R)-3-(cyclopropylamino)-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide |
| SMILES | CC#CCOc1ccc(C(=O)N[C@H](C(=O)NO)[C@@H](C)NC2CC2)cc1 |
| InChI | InChI=1S/C18H23N3O4/c1-3-4-11-25-15-9-5-13(6-10-15)17(22)20-16(18(23)21-24)12(2)19-14-7-8-14/h5-6,9-10,12,14,16,19,24H,7-8,11H2,1-2H3,(H,20,22)(H,21,23)/t12-,16+/m1/s1 |
| InChIKey | AXHUHDPZKLECPW-WBMJQRKESA-N |
| XLogP | 0.83 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|