C19H25N3O4 — CID 50990949
4-but-2-ynoxy-N-[(2S)-3-(hydroxyamino)-3-oxo-2-piperidin-1-ylpropyl]benzamide (PubChem CID 50990949) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is 4-but-2-ynoxy-N-[(2S)-3-(hydroxyamino)-3-oxo-2-piperidin-1-ylpropyl]benzamide.
| Compound Name | 4-but-2-ynoxy-N-[(2S)-3-(hydroxyamino)-3-oxo-2-piperidin-1-ylpropyl]benzamide |
|---|---|
| PubChem CID | 50990949 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 4-but-2-ynoxy-N-[(2S)-3-(hydroxyamino)-3-oxo-2-piperidin-1-ylpropyl]benzamide |
| SMILES | CC#CCOc1ccc(C(=O)NC[C@@H](C(=O)NO)N2CCCCC2)cc1 |
| InChI | InChI=1S/C19H25N3O4/c1-2-3-13-26-16-9-7-15(8-10-16)18(23)20-14-17(19(24)21-25)22-11-5-4-6-12-22/h7-10,17,25H,4-6,11-14H2,1H3,(H,20,23)(H,21,24)/t17-/m0/s1 |
| InChIKey | LFORXWHNWSTJGB-KRWDZBQOSA-N |
| XLogP | 1.18 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|