C23H25N3O4 — CID 67056388
3-[[4-[(4-cyanophenyl)methoxy]benzoyl]amino]-2-piperidin-1-ylpropanoic acid (PubChem CID 67056388) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is 3-[[4-[(4-cyanophenyl)methoxy]benzoyl]amino]-2-piperidin-1-ylpropanoic acid.
| Compound Name | 3-[[4-[(4-cyanophenyl)methoxy]benzoyl]amino]-2-piperidin-1-ylpropanoic acid |
|---|---|
| PubChem CID | 67056388 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 3-[[4-[(4-cyanophenyl)methoxy]benzoyl]amino]-2-piperidin-1-ylpropanoic acid |
| SMILES | N#Cc1ccc(COc2ccc(C(=O)NCC(C(=O)O)N3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C23H25N3O4/c24-14-17-4-6-18(7-5-17)16-30-20-10-8-19(9-11-20)22(27)25-15-21(23(28)29)26-12-2-1-3-13-26/h4-11,21H,1-3,12-13,15-16H2,(H,25,27)(H,28,29) |
| InChIKey | XZZJZXIVBLJUTD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 102.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |