C20H26N2O4 — CID 123687132
methyl 3-[(4-but-2-ynoxybenzoyl)amino]-2-piperidin-1-ylpropanoate (PubChem CID 123687132) has the molecular formula C20H26N2O4 and a molecular weight of 358.44 g/mol. Its IUPAC name is methyl 3-[(4-but-2-ynoxybenzoyl)amino]-2-piperidin-1-ylpropanoate.
| Compound Name | methyl 3-[(4-but-2-ynoxybenzoyl)amino]-2-piperidin-1-ylpropanoate |
|---|---|
| PubChem CID | 123687132 |
| Molecular Formula | C20H26N2O4 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | methyl 3-[(4-but-2-ynoxybenzoyl)amino]-2-piperidin-1-ylpropanoate |
| SMILES | CC#CCOc1ccc(C(=O)NCC(C(=O)OC)N2CCCCC2)cc1 |
| InChI | InChI=1S/C20H26N2O4/c1-3-4-14-26-17-10-8-16(9-11-17)19(23)21-15-18(20(24)25-2)22-12-6-5-7-13-22/h8-11,18H,5-7,12-15H2,1-2H3,(H,21,23) |
| InChIKey | LPXVMCNSHPOYGY-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|