C22H26BrN3O4 — CID 88876311
methyl 3-[[4-[(2-bromo-4-pyridinyl)methoxy]benzoyl]amino]-2-piperidin-1-ylpropanoate (PubChem CID 88876311) has the molecular formula C22H26BrN3O4 and a molecular weight of 476.37 g/mol. Its IUPAC name is methyl 3-[[4-[(2-bromo-4-pyridinyl)methoxy]benzoyl]amino]-2-piperidin-1-ylpropanoate.
| Compound Name | methyl 3-[[4-[(2-bromo-4-pyridinyl)methoxy]benzoyl]amino]-2-piperidin-1-ylpropanoate |
|---|---|
| PubChem CID | 88876311 |
| Molecular Formula | C22H26BrN3O4 |
| Molecular Weight | 476.37 g/mol |
| Exact Mass | 475.11 |
| IUPAC Name | methyl 3-[[4-[(2-bromo-4-pyridinyl)methoxy]benzoyl]amino]-2-piperidin-1-ylpropanoate |
| SMILES | COC(=O)C(CNC(=O)c1ccc(OCc2ccnc(Br)c2)cc1)N1CCCCC1 |
| InChI | InChI=1S/C22H26BrN3O4/c1-29-22(28)19(26-11-3-2-4-12-26)14-25-21(27)17-5-7-18(8-6-17)30-15-16-9-10-24-20(23)13-16/h5-10,13,19H,2-4,11-12,14-15H2,1H3,(H,25,27) |
| InChIKey | HLMSDFPGCKUJOA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|