C27H35N5O5 — CID 75600381
N-[2-(4-benzoylpiperazin-1-yl)-3-(hydroxyamino)-3-oxopropyl]-4-(piperidin-4-ylmethoxy)benzamide (PubChem CID 75600381) has the molecular formula C27H35N5O5 and a molecular weight of 509.61 g/mol. Its IUPAC name is N-[2-(4-benzoylpiperazin-1-yl)-3-(hydroxyamino)-3-oxopropyl]-4-(piperidin-4-ylmethoxy)benzamide.
| Compound Name | N-[2-(4-benzoylpiperazin-1-yl)-3-(hydroxyamino)-3-oxopropyl]-4-(piperidin-4-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 75600381 |
| Molecular Formula | C27H35N5O5 |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.26 |
| IUPAC Name | N-[2-(4-benzoylpiperazin-1-yl)-3-(hydroxyamino)-3-oxopropyl]-4-(piperidin-4-ylmethoxy)benzamide |
| SMILES | O=C(NCC(C(=O)NO)N1CCN(C(=O)c2ccccc2)CC1)c1ccc(OCC2CCNCC2)cc1 |
| InChI | InChI=1S/C27H35N5O5/c33-25(21-6-8-23(9-7-21)37-19-20-10-12-28-13-11-20)29-18-24(26(34)30-36)31-14-16-32(17-15-31)27(35)22-4-2-1-3-5-22/h1-9,20,24,28,36H,10-19H2,(H,29,33)(H,30,34) |
| InChIKey | RCFJGBJYLWCXJI-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 123.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|