C29H35N5O5 — CID 51030462
N-[(2S)-3-(hydroxyamino)-2-[4-(2-methylpropanoyl)piperazin-1-yl]-3-oxopropyl]-4-[(2-methylquinolin-4-yl)methoxy]benzamide (PubChem CID 51030462) has the molecular formula C29H35N5O5 and a molecular weight of 533.63 g/mol. Its IUPAC name is N-[(2S)-3-(hydroxyamino)-2-[4-(2-methylpropanoyl)piperazin-1-yl]-3-oxopropyl]-4-[(2-methylquinolin-4-yl)methoxy]benzamide.
| Compound Name | N-[(2S)-3-(hydroxyamino)-2-[4-(2-methylpropanoyl)piperazin-1-yl]-3-oxopropyl]-4-[(2-methylquinolin-4-yl)methoxy]benzamide |
|---|---|
| PubChem CID | 51030462 |
| Molecular Formula | C29H35N5O5 |
| Molecular Weight | 533.63 g/mol |
| Exact Mass | 533.26 |
| IUPAC Name | N-[(2S)-3-(hydroxyamino)-2-[4-(2-methylpropanoyl)piperazin-1-yl]-3-oxopropyl]-4-[(2-methylquinolin-4-yl)methoxy]benzamide |
| SMILES | Cc1cc(COc2ccc(C(=O)NCC(C(=O)NO)N3CCN(C(=O)C(C)C)CC3)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C29H35N5O5/c1-19(2)29(37)34-14-12-33(13-15-34)26(28(36)32-38)17-30-27(35)21-8-10-23(11-9-21)39-18-22-16-20(3)31-25-7-5-4-6-24(22)25/h4-11,16,19,26,38H,12-15,17-18H2,1-3H3,(H,30,35)(H,32,36) |
| InChIKey | VLJLCPMYKZOXSI-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 124.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.63 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|